C14H15ClN4O — CID 80752845
1-N-(5-chloro-2-methoxypyrimidin-4-yl)-2,3-dihydro-1H-indene-1,5-diamine (PubChem CID 80752845) has the molecular formula C14H15ClN4O and a molecular weight of 290.75 g/mol. Its IUPAC name is 1-N-(5-chloro-2-methoxypyrimidin-4-yl)-2,3-dihydro-1H-indene-1,5-diamine.
| Compound Name | 1-N-(5-chloro-2-methoxypyrimidin-4-yl)-2,3-dihydro-1H-indene-1,5-diamine |
|---|---|
| PubChem CID | 80752845 |
| Molecular Formula | C14H15ClN4O |
| Molecular Weight | 290.75 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 1-N-(5-chloro-2-methoxypyrimidin-4-yl)-2,3-dihydro-1H-indene-1,5-diamine |
| SMILES | COc1ncc(Cl)c(NC2CCc3cc(N)ccc32)n1 |
| InChI | InChI=1S/C14H15ClN4O/c1-20-14-17-7-11(15)13(19-14)18-12-5-2-8-6-9(16)3-4-10(8)12/h3-4,6-7,12H,2,5,16H2,1H3,(H,17,18,19) |
| InChIKey | WXVLWYRQKLKDNP-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.75 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|