C14H12FNO3 — CID 80752885
1-(3-fluoro-5-nitrophenoxy)-2,4-dimethylbenzene (PubChem CID 80752885) has the molecular formula C14H12FNO3 and a molecular weight of 261.25 g/mol. Its IUPAC name is 1-(3-fluoro-5-nitrophenoxy)-2,4-dimethylbenzene.
| Compound Name | 1-(3-fluoro-5-nitrophenoxy)-2,4-dimethylbenzene |
|---|---|
| PubChem CID | 80752885 |
| Molecular Formula | C14H12FNO3 |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 1-(3-fluoro-5-nitrophenoxy)-2,4-dimethylbenzene |
| SMILES | Cc1ccc(Oc2cc(F)cc([N+](=O)[O-])c2)c(C)c1 |
| InChI | InChI=1S/C14H12FNO3/c1-9-3-4-14(10(2)5-9)19-13-7-11(15)6-12(8-13)16(17)18/h3-8H,1-2H3 |
| InChIKey | KKIRKMNYORKXPC-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|