About (2R)-2-[(3,5-dimethyladamantane-1-carbonyl)amino]-3-hydroxypropanoic acid
(2R)-2-[(3,5-dimethyladamantane-1-carbonyl)amino]-3-hydroxypropanoic acid (PubChem CID 80752979) has the molecular formula C16H25NO4
and a molecular weight of 295.38 g/mol. Its IUPAC name is (2R)-2-[(3,5-dimethyladamantane-1-carbonyl)amino]-3-hydroxypropanoic acid.
Molecular Properties
| Compound Name | (2R)-2-[(3,5-dimethyladamantane-1-carbonyl)amino]-3-hydroxypropanoic acid |
| PubChem CID | 80752979 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | (2R)-2-[(3,5-dimethyladamantane-1-carbonyl)amino]-3-hydroxypropanoic acid |
| SMILES | CC12CC3CC(C)(C1)CC(C(=O)N[C@H](CO)C(=O)O)(C3)C2 |
| InChI | InChI=1S/C16H25NO4/c1-14-3-10-4-15(2,7-14)9-16(5-10,8-14)13(21)17-11(6-18)12(19)20/h10-11,18H,3-9H2,1-2H3,(H,17,21)(H,19,20)/t10?,11-,14?,15?,16?/m1/s1 |
| InChIKey | BLUNULJENDVENB-SWRRYOCXSA-N |
| XLogP | 1.54 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-2-[(3,5-dimethyladamantane-1-carbonyl)amino]-3-hydroxypropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[(3,5-dimethyladamantane-1-carbonyl)amino]-3-hydroxypropanoic acid?
The IUPAC name of (2R)-2-[(3,5-dimethyladamantane-1-carbonyl)amino]-3-hydroxypropanoic acid (CID 80752979) is (2R)-2-[(3,5-dimethyladamantane-1-carbonyl)amino]-3-hydroxypropanoic acid.
What is the SMILES notation for (2R)-2-[(3,5-dimethyladamantane-1-carbonyl)amino]-3-hydroxypropanoic acid?
The canonical SMILES for (2R)-2-[(3,5-dimethyladamantane-1-carbonyl)amino]-3-hydroxypropanoic acid is CC12CC3CC(C)(C1)CC(C(=O)N[C@H](CO)C(=O)O)(C3)C2.
What is the InChIKey of (2R)-2-[(3,5-dimethyladamantane-1-carbonyl)amino]-3-hydroxypropanoic acid?
The InChIKey is BLUNULJENDVENB-SWRRYOCXSA-N. The full InChI is InChI=1S/C16H25NO4/c1-14-3-10-4-15(2,7-14)9-16(5-10,8-14)13(21)17-11(6-18)12(19)20/h10-11,18H,3-9H2,1-2H3,(H,17,21)(H,19,20)/t10?,11-,14?,15?,16?/m1/s1.
What are the key properties of (2R)-2-[(3,5-dimethyladamantane-1-carbonyl)amino]-3-hydroxypropanoic acid?
(2R)-2-[(3,5-dimethyladamantane-1-carbonyl)amino]-3-hydroxypropanoic acid has a molecular weight of 295.38 g/mol, XLogP of 1.54, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(3,5-dimethyladamantane-1-carbonyl)amino]-3-hydroxypropanoic acid is sourced from PubChem (CID 80752979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).