C10H9Cl2N5O — CID 80755049
2-N-(2,3-dichlorophenyl)-6-methoxy-1,3,5-triazine-2,4-diamine (PubChem CID 80755049) has the molecular formula C10H9Cl2N5O and a molecular weight of 286.12 g/mol. Its IUPAC name is 2-N-(2,3-dichlorophenyl)-6-methoxy-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(2,3-dichlorophenyl)-6-methoxy-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80755049 |
| Molecular Formula | C10H9Cl2N5O |
| Molecular Weight | 286.12 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | 2-N-(2,3-dichlorophenyl)-6-methoxy-1,3,5-triazine-2,4-diamine |
| SMILES | COc1nc(N)nc(Nc2cccc(Cl)c2Cl)n1 |
| InChI | InChI=1S/C10H9Cl2N5O/c1-18-10-16-8(13)15-9(17-10)14-6-4-2-3-5(11)7(6)12/h2-4H,1H3,(H3,13,14,15,16,17) |
| InChIKey | YIYNIRCMLCLRQL-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.12 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |