C11H18N6O — CID 80756026
1-[2-amino-6-(methylamino)pyrimidin-4-yl]piperidine-3-carboxamide (PubChem CID 80756026) has the molecular formula C11H18N6O and a molecular weight of 250.31 g/mol. Its IUPAC name is 1-[2-amino-6-(methylamino)pyrimidin-4-yl]piperidine-3-carboxamide.
| Compound Name | 1-[2-amino-6-(methylamino)pyrimidin-4-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 80756026 |
| Molecular Formula | C11H18N6O |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 1-[2-amino-6-(methylamino)pyrimidin-4-yl]piperidine-3-carboxamide |
| SMILES | CNc1cc(N2CCCC(C(N)=O)C2)nc(N)n1 |
| InChI | InChI=1S/C11H18N6O/c1-14-8-5-9(16-11(13)15-8)17-4-2-3-7(6-17)10(12)18/h5,7H,2-4,6H2,1H3,(H2,12,18)(H3,13,14,15,16) |
| InChIKey | VPRUJFVNGYUGDY-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |