C15H20N4 — CID 80756431
2-N-ethyl-2-N-phenyl-6-N-propylpyrazine-2,6-diamine (PubChem CID 80756431) has the molecular formula C15H20N4 and a molecular weight of 256.35 g/mol. Its IUPAC name is 2-N-ethyl-2-N-phenyl-6-N-propylpyrazine-2,6-diamine.
| Compound Name | 2-N-ethyl-2-N-phenyl-6-N-propylpyrazine-2,6-diamine |
|---|---|
| PubChem CID | 80756431 |
| Molecular Formula | C15H20N4 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 2-N-ethyl-2-N-phenyl-6-N-propylpyrazine-2,6-diamine |
| SMILES | CCCNc1cncc(N(CC)c2ccccc2)n1 |
| InChI | InChI=1S/C15H20N4/c1-3-10-17-14-11-16-12-15(18-14)19(4-2)13-8-6-5-7-9-13/h5-9,11-12H,3-4,10H2,1-2H3,(H,17,18) |
| InChIKey | JAWIQMMMMXQUDU-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |