C15H20N6 — CID 80756957
4-N-ethyl-4-N-phenyl-6-pyrrolidin-1-yl-1,3,5-triazine-2,4-diamine (PubChem CID 80756957) has the molecular formula C15H20N6 and a molecular weight of 284.37 g/mol. Its IUPAC name is 4-N-ethyl-4-N-phenyl-6-pyrrolidin-1-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-ethyl-4-N-phenyl-6-pyrrolidin-1-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80756957 |
| Molecular Formula | C15H20N6 |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 4-N-ethyl-4-N-phenyl-6-pyrrolidin-1-yl-1,3,5-triazine-2,4-diamine |
| SMILES | CCN(c1ccccc1)c1nc(N)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C15H20N6/c1-2-21(12-8-4-3-5-9-12)15-18-13(16)17-14(19-15)20-10-6-7-11-20/h3-5,8-9H,2,6-7,10-11H2,1H3,(H2,16,17,18,19) |
| InChIKey | CDBLEPDDOHIVAR-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |