About 6-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)pyrimidine-2,4-diamine
6-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)pyrimidine-2,4-diamine (PubChem CID 80757302) has the molecular formula C14H17N5
and a molecular weight of 255.33 g/mol. Its IUPAC name is 6-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 6-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)pyrimidine-2,4-diamine |
| PubChem CID | 80757302 |
| Molecular Formula | C14H17N5 |
| Molecular Weight | 255.33 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 6-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)pyrimidine-2,4-diamine |
| SMILES | CC1CCc2ccccc2N1c1cc(N)nc(N)n1 |
| InChI | InChI=1S/C14H17N5/c1-9-6-7-10-4-2-3-5-11(10)19(9)13-8-12(15)17-14(16)18-13/h2-5,8-9H,6-7H2,1H3,(H4,15,16,17,18) |
| InChIKey | NOCXLJJNLOMBNQ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.33 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)pyrimidine-2,4-diamine?
The IUPAC name of 6-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)pyrimidine-2,4-diamine (CID 80757302) is 6-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)pyrimidine-2,4-diamine.
What is the SMILES notation for 6-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)pyrimidine-2,4-diamine?
The canonical SMILES for 6-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)pyrimidine-2,4-diamine is CC1CCc2ccccc2N1c1cc(N)nc(N)n1.
What is the InChIKey of 6-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)pyrimidine-2,4-diamine?
The InChIKey is NOCXLJJNLOMBNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N5/c1-9-6-7-10-4-2-3-5-11(10)19(9)13-8-12(15)17-14(16)18-13/h2-5,8-9H,6-7H2,1H3,(H4,15,16,17,18).
What are the key properties of 6-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)pyrimidine-2,4-diamine?
6-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)pyrimidine-2,4-diamine has a molecular weight of 255.33 g/mol, XLogP of 2.11, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)pyrimidine-2,4-diamine is sourced from PubChem (CID 80757302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).