C13H19ClN4O — CID 80758287
(3aR,7aS)-2-(5-chloro-2-methoxypyrimidin-4-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine (PubChem CID 80758287) has the molecular formula C13H19ClN4O and a molecular weight of 282.77 g/mol. Its IUPAC name is (3aR,7aS)-2-(5-chloro-2-methoxypyrimidin-4-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine.
| Compound Name | (3aR,7aS)-2-(5-chloro-2-methoxypyrimidin-4-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine |
|---|---|
| PubChem CID | 80758287 |
| Molecular Formula | C13H19ClN4O |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | (3aR,7aS)-2-(5-chloro-2-methoxypyrimidin-4-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine |
| SMILES | COc1ncc(Cl)c(N2C[C@H]3CCC(N)C[C@H]3C2)n1 |
| InChI | InChI=1S/C13H19ClN4O/c1-19-13-16-5-11(14)12(17-13)18-6-8-2-3-10(15)4-9(8)7-18/h5,8-10H,2-4,6-7,15H2,1H3/t8-,9+,10?/m1/s1 |
| InChIKey | LZAYLHHOTYSZGA-ZDGBYWQASA-N |
| XLogP | 1.70 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |