C9H11ClF3N3O2 — CID 80758824
5-chloro-2-methoxy-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-amine (PubChem CID 80758824) has the molecular formula C9H11ClF3N3O2 and a molecular weight of 285.65 g/mol. Its IUPAC name is 5-chloro-2-methoxy-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-amine.
| Compound Name | 5-chloro-2-methoxy-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 80758824 |
| Molecular Formula | C9H11ClF3N3O2 |
| Molecular Weight | 285.65 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | 5-chloro-2-methoxy-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-amine |
| SMILES | COc1ncc(Cl)c(NCCOCC(F)(F)F)n1 |
| InChI | InChI=1S/C9H11ClF3N3O2/c1-17-8-15-4-6(10)7(16-8)14-2-3-18-5-9(11,12)13/h4H,2-3,5H2,1H3,(H,14,15,16) |
| InChIKey | GPROYTOOSIZEJG-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.65 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|