C14H13FN2O2S — CID 80759014
5-fluoro-3-hydroxy-6-[methyl(thiophen-2-ylmethyl)amino]-1,3-dihydroindol-2-one (PubChem CID 80759014) has the molecular formula C14H13FN2O2S and a molecular weight of 292.33 g/mol. Its IUPAC name is 5-fluoro-3-hydroxy-6-[methyl(thiophen-2-ylmethyl)amino]-1,3-dihydroindol-2-one.
| Compound Name | 5-fluoro-3-hydroxy-6-[methyl(thiophen-2-ylmethyl)amino]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 80759014 |
| Molecular Formula | C14H13FN2O2S |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 5-fluoro-3-hydroxy-6-[methyl(thiophen-2-ylmethyl)amino]-1,3-dihydroindol-2-one |
| SMILES | CN(Cc1cccs1)c1cc2c(cc1F)C(O)C(=O)N2 |
| InChI | InChI=1S/C14H13FN2O2S/c1-17(7-8-3-2-4-20-8)12-6-11-9(5-10(12)15)13(18)14(19)16-11/h2-6,13,18H,7H2,1H3,(H,16,19) |
| InChIKey | PQHQPEFKGASBNH-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|