C11H11Cl2N5 — CID 80759587
4-N-(2,4-dichlorophenyl)-6-N-methylpyrimidine-2,4,6-triamine (PubChem CID 80759587) has the molecular formula C11H11Cl2N5 and a molecular weight of 284.15 g/mol. Its IUPAC name is 4-N-(2,4-dichlorophenyl)-6-N-methylpyrimidine-2,4,6-triamine.
| Compound Name | 4-N-(2,4-dichlorophenyl)-6-N-methylpyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 80759587 |
| Molecular Formula | C11H11Cl2N5 |
| Molecular Weight | 284.15 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | 4-N-(2,4-dichlorophenyl)-6-N-methylpyrimidine-2,4,6-triamine |
| SMILES | CNc1cc(Nc2ccc(Cl)cc2Cl)nc(N)n1 |
| InChI | InChI=1S/C11H11Cl2N5/c1-15-9-5-10(18-11(14)17-9)16-8-3-2-6(12)4-7(8)13/h2-5H,1H3,(H4,14,15,16,17,18) |
| InChIKey | PFUCVOWAPWSXJL-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.15 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |