C12H10BrCl3N4 — CID 80759727
5-bromo-2-N-ethyl-4-N-(2,4,5-trichlorophenyl)pyrimidine-2,4-diamine (PubChem CID 80759727) has the molecular formula C12H10BrCl3N4 and a molecular weight of 396.50 g/mol. Its IUPAC name is 5-bromo-2-N-ethyl-4-N-(2,4,5-trichlorophenyl)pyrimidine-2,4-diamine.
| Compound Name | 5-bromo-2-N-ethyl-4-N-(2,4,5-trichlorophenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80759727 |
| Molecular Formula | C12H10BrCl3N4 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 393.92 |
| IUPAC Name | 5-bromo-2-N-ethyl-4-N-(2,4,5-trichlorophenyl)pyrimidine-2,4-diamine |
| SMILES | CCNc1ncc(Br)c(Nc2cc(Cl)c(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C12H10BrCl3N4/c1-2-17-12-18-5-6(13)11(20-12)19-10-4-8(15)7(14)3-9(10)16/h3-5H,2H2,1H3,(H2,17,18,19,20) |
| InChIKey | ZNCDCKPGKUJQOO-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|