C14H18N4O — CID 80762592
4-N-(2-ethoxyphenyl)-2,5-dimethylpyrimidine-4,6-diamine (PubChem CID 80762592) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is 4-N-(2-ethoxyphenyl)-2,5-dimethylpyrimidine-4,6-diamine.
| Compound Name | 4-N-(2-ethoxyphenyl)-2,5-dimethylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80762592 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 4-N-(2-ethoxyphenyl)-2,5-dimethylpyrimidine-4,6-diamine |
| SMILES | CCOc1ccccc1Nc1nc(C)nc(N)c1C |
| InChI | InChI=1S/C14H18N4O/c1-4-19-12-8-6-5-7-11(12)18-14-9(2)13(15)16-10(3)17-14/h5-8H,4H2,1-3H3,(H3,15,16,17,18) |
| InChIKey | KVZUIRMUCGCMAL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |