C13H16ClN5O — CID 80762923
4-N-(3-chloro-4-methoxyphenyl)-6-N-ethylpyrimidine-2,4,6-triamine (PubChem CID 80762923) has the molecular formula C13H16ClN5O and a molecular weight of 293.76 g/mol. Its IUPAC name is 4-N-(3-chloro-4-methoxyphenyl)-6-N-ethylpyrimidine-2,4,6-triamine.
| Compound Name | 4-N-(3-chloro-4-methoxyphenyl)-6-N-ethylpyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 80762923 |
| Molecular Formula | C13H16ClN5O |
| Molecular Weight | 293.76 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 4-N-(3-chloro-4-methoxyphenyl)-6-N-ethylpyrimidine-2,4,6-triamine |
| SMILES | CCNc1cc(Nc2ccc(OC)c(Cl)c2)nc(N)n1 |
| InChI | InChI=1S/C13H16ClN5O/c1-3-16-11-7-12(19-13(15)18-11)17-8-4-5-10(20-2)9(14)6-8/h4-7H,3H2,1-2H3,(H4,15,16,17,18,19) |
| InChIKey | GFQPIYOZEORQGL-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.76 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |