About 5-chloro-4-N-(2,4-dimethoxyphenyl)pyrimidine-2,4-diamine
5-chloro-4-N-(2,4-dimethoxyphenyl)pyrimidine-2,4-diamine (PubChem CID 80763334) has the molecular formula C12H13ClN4O2
and a molecular weight of 280.72 g/mol. Its IUPAC name is 5-chloro-4-N-(2,4-dimethoxyphenyl)pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 5-chloro-4-N-(2,4-dimethoxyphenyl)pyrimidine-2,4-diamine |
| PubChem CID | 80763334 |
| Molecular Formula | C12H13ClN4O2 |
| Molecular Weight | 280.72 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 5-chloro-4-N-(2,4-dimethoxyphenyl)pyrimidine-2,4-diamine |
| SMILES | COc1ccc(Nc2nc(N)ncc2Cl)c(OC)c1 |
| InChI | InChI=1S/C12H13ClN4O2/c1-18-7-3-4-9(10(5-7)19-2)16-11-8(13)6-15-12(14)17-11/h3-6H,1-2H3,(H3,14,15,16,17) |
| InChIKey | CXWFBPCQSHCMST-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.72 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-chloro-4-N-(2,4-dimethoxyphenyl)pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-4-N-(2,4-dimethoxyphenyl)pyrimidine-2,4-diamine?
The IUPAC name of 5-chloro-4-N-(2,4-dimethoxyphenyl)pyrimidine-2,4-diamine (CID 80763334) is 5-chloro-4-N-(2,4-dimethoxyphenyl)pyrimidine-2,4-diamine.
What is the SMILES notation for 5-chloro-4-N-(2,4-dimethoxyphenyl)pyrimidine-2,4-diamine?
The canonical SMILES for 5-chloro-4-N-(2,4-dimethoxyphenyl)pyrimidine-2,4-diamine is COc1ccc(Nc2nc(N)ncc2Cl)c(OC)c1.
What is the InChIKey of 5-chloro-4-N-(2,4-dimethoxyphenyl)pyrimidine-2,4-diamine?
The InChIKey is CXWFBPCQSHCMST-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClN4O2/c1-18-7-3-4-9(10(5-7)19-2)16-11-8(13)6-15-12(14)17-11/h3-6H,1-2H3,(H3,14,15,16,17).
What are the key properties of 5-chloro-4-N-(2,4-dimethoxyphenyl)pyrimidine-2,4-diamine?
5-chloro-4-N-(2,4-dimethoxyphenyl)pyrimidine-2,4-diamine has a molecular weight of 280.72 g/mol, XLogP of 2.47, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-4-N-(2,4-dimethoxyphenyl)pyrimidine-2,4-diamine is sourced from PubChem (CID 80763334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).