C13H15ClN4O — CID 80763652
4-N-(5-chloro-2-methoxyphenyl)-2-N-ethylpyrimidine-2,4-diamine (PubChem CID 80763652) has the molecular formula C13H15ClN4O and a molecular weight of 278.74 g/mol. Its IUPAC name is 4-N-(5-chloro-2-methoxyphenyl)-2-N-ethylpyrimidine-2,4-diamine.
| Compound Name | 4-N-(5-chloro-2-methoxyphenyl)-2-N-ethylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80763652 |
| Molecular Formula | C13H15ClN4O |
| Molecular Weight | 278.74 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 4-N-(5-chloro-2-methoxyphenyl)-2-N-ethylpyrimidine-2,4-diamine |
| SMILES | CCNc1nccc(Nc2cc(Cl)ccc2OC)n1 |
| InChI | InChI=1S/C13H15ClN4O/c1-3-15-13-16-7-6-12(18-13)17-10-8-9(14)4-5-11(10)19-2/h4-8H,3H2,1-2H3,(H2,15,16,17,18) |
| InChIKey | BDRDTIVXNOJJBZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.74 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |