C10H15BrN4S — CID 80763982
5-bromo-N-ethyl-4-thiomorpholin-4-ylpyrimidin-2-amine (PubChem CID 80763982) has the molecular formula C10H15BrN4S and a molecular weight of 303.23 g/mol. Its IUPAC name is 5-bromo-N-ethyl-4-thiomorpholin-4-ylpyrimidin-2-amine.
| Compound Name | 5-bromo-N-ethyl-4-thiomorpholin-4-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 80763982 |
| Molecular Formula | C10H15BrN4S |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | 5-bromo-N-ethyl-4-thiomorpholin-4-ylpyrimidin-2-amine |
| SMILES | CCNc1ncc(Br)c(N2CCSCC2)n1 |
| InChI | InChI=1S/C10H15BrN4S/c1-2-12-10-13-7-8(11)9(14-10)15-3-5-16-6-4-15/h7H,2-6H2,1H3,(H,12,13,14) |
| InChIKey | DAUFFJMZSLONAO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |