About 4-N-cyclohexyl-6-N-methylpyrimidine-2,4,6-triamine
4-N-cyclohexyl-6-N-methylpyrimidine-2,4,6-triamine (PubChem CID 80765698) has the molecular formula C11H19N5
and a molecular weight of 221.31 g/mol. Its IUPAC name is 4-N-cyclohexyl-6-N-methylpyrimidine-2,4,6-triamine.
Molecular Properties
| Compound Name | 4-N-cyclohexyl-6-N-methylpyrimidine-2,4,6-triamine |
| PubChem CID | 80765698 |
| Molecular Formula | C11H19N5 |
| Molecular Weight | 221.31 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | 4-N-cyclohexyl-6-N-methylpyrimidine-2,4,6-triamine |
| SMILES | CNc1cc(NC2CCCCC2)nc(N)n1 |
| InChI | InChI=1S/C11H19N5/c1-13-9-7-10(16-11(12)15-9)14-8-5-3-2-4-6-8/h7-8H,2-6H2,1H3,(H4,12,13,14,15,16) |
| InChIKey | FMZHTSCRFOGVTN-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-N-cyclohexyl-6-N-methylpyrimidine-2,4,6-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-cyclohexyl-6-N-methylpyrimidine-2,4,6-triamine?
The IUPAC name of 4-N-cyclohexyl-6-N-methylpyrimidine-2,4,6-triamine (CID 80765698) is 4-N-cyclohexyl-6-N-methylpyrimidine-2,4,6-triamine.
What is the SMILES notation for 4-N-cyclohexyl-6-N-methylpyrimidine-2,4,6-triamine?
The canonical SMILES for 4-N-cyclohexyl-6-N-methylpyrimidine-2,4,6-triamine is CNc1cc(NC2CCCCC2)nc(N)n1.
What is the InChIKey of 4-N-cyclohexyl-6-N-methylpyrimidine-2,4,6-triamine?
The InChIKey is FMZHTSCRFOGVTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N5/c1-13-9-7-10(16-11(12)15-9)14-8-5-3-2-4-6-8/h7-8H,2-6H2,1H3,(H4,12,13,14,15,16).
What are the key properties of 4-N-cyclohexyl-6-N-methylpyrimidine-2,4,6-triamine?
4-N-cyclohexyl-6-N-methylpyrimidine-2,4,6-triamine has a molecular weight of 221.31 g/mol, XLogP of 1.85, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-cyclohexyl-6-N-methylpyrimidine-2,4,6-triamine is sourced from PubChem (CID 80765698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).