C14H25N5O — CID 80766247
2-N-cyclohexyl-6-ethoxy-4-N-propyl-1,3,5-triazine-2,4-diamine (PubChem CID 80766247) has the molecular formula C14H25N5O and a molecular weight of 279.39 g/mol. Its IUPAC name is 2-N-cyclohexyl-6-ethoxy-4-N-propyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-cyclohexyl-6-ethoxy-4-N-propyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80766247 |
| Molecular Formula | C14H25N5O |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.21 |
| IUPAC Name | 2-N-cyclohexyl-6-ethoxy-4-N-propyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCCNc1nc(NC2CCCCC2)nc(OCC)n1 |
| InChI | InChI=1S/C14H25N5O/c1-3-10-15-12-17-13(19-14(18-12)20-4-2)16-11-8-6-5-7-9-11/h11H,3-10H2,1-2H3,(H2,15,16,17,18,19) |
| InChIKey | NFEUMJJUUKVGOD-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |