C9H15N5 — CID 80766375
4-N-cyclopropyl-6-N-ethylpyrimidine-2,4,6-triamine (PubChem CID 80766375) has the molecular formula C9H15N5 and a molecular weight of 193.25 g/mol. Its IUPAC name is 4-N-cyclopropyl-6-N-ethylpyrimidine-2,4,6-triamine.
| Compound Name | 4-N-cyclopropyl-6-N-ethylpyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 80766375 |
| Molecular Formula | C9H15N5 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | 4-N-cyclopropyl-6-N-ethylpyrimidine-2,4,6-triamine |
| SMILES | CCNc1cc(NC2CC2)nc(N)n1 |
| InChI | InChI=1S/C9H15N5/c1-2-11-7-5-8(12-6-3-4-6)14-9(10)13-7/h5-6H,2-4H2,1H3,(H4,10,11,12,13,14) |
| InChIKey | SVXZIXSKIBBMPJ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |