C13H23N5O — CID 80767376
2-[1-[2-amino-6-(ethylamino)pyrimidin-4-yl]piperidin-2-yl]ethanol (PubChem CID 80767376) has the molecular formula C13H23N5O and a molecular weight of 265.36 g/mol. Its IUPAC name is 2-[1-[2-amino-6-(ethylamino)pyrimidin-4-yl]piperidin-2-yl]ethanol.
| Compound Name | 2-[1-[2-amino-6-(ethylamino)pyrimidin-4-yl]piperidin-2-yl]ethanol |
|---|---|
| PubChem CID | 80767376 |
| Molecular Formula | C13H23N5O |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.19 |
| IUPAC Name | 2-[1-[2-amino-6-(ethylamino)pyrimidin-4-yl]piperidin-2-yl]ethanol |
| SMILES | CCNc1cc(N2CCCCC2CCO)nc(N)n1 |
| InChI | InChI=1S/C13H23N5O/c1-2-15-11-9-12(17-13(14)16-11)18-7-4-3-5-10(18)6-8-19/h9-10,19H,2-8H2,1H3,(H3,14,15,16,17) |
| InChIKey | IJEMZUANTRZAFN-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |