C11H20N4 — CID 80769091
4-N-tert-butyl-2-N-ethyl-5-methylpyrimidine-2,4-diamine (PubChem CID 80769091) has the molecular formula C11H20N4 and a molecular weight of 208.31 g/mol. Its IUPAC name is 4-N-tert-butyl-2-N-ethyl-5-methylpyrimidine-2,4-diamine.
| Compound Name | 4-N-tert-butyl-2-N-ethyl-5-methylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80769091 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | 4-N-tert-butyl-2-N-ethyl-5-methylpyrimidine-2,4-diamine |
| SMILES | CCNc1ncc(C)c(NC(C)(C)C)n1 |
| InChI | InChI=1S/C11H20N4/c1-6-12-10-13-7-8(2)9(14-10)15-11(3,4)5/h7H,6H2,1-5H3,(H2,12,13,14,15) |
| InChIKey | GFMYZERSNOUFES-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |