C17H30N4 — CID 80771503
4-N-(cyclohexylmethyl)-6-N,5-dipropylpyrimidine-4,6-diamine (PubChem CID 80771503) has the molecular formula C17H30N4 and a molecular weight of 290.45 g/mol. Its IUPAC name is 4-N-(cyclohexylmethyl)-6-N,5-dipropylpyrimidine-4,6-diamine.
| Compound Name | 4-N-(cyclohexylmethyl)-6-N,5-dipropylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80771503 |
| Molecular Formula | C17H30N4 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.25 |
| IUPAC Name | 4-N-(cyclohexylmethyl)-6-N,5-dipropylpyrimidine-4,6-diamine |
| SMILES | CCCNc1ncnc(NCC2CCCCC2)c1CCC |
| InChI | InChI=1S/C17H30N4/c1-3-8-15-16(18-11-4-2)20-13-21-17(15)19-12-14-9-6-5-7-10-14/h13-14H,3-12H2,1-2H3,(H2,18,19,20,21) |
| InChIKey | FGYKQGMTFCYZCL-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |