C11H14F3N7 — CID 80772312
4-N-propyl-6-pyrazol-1-yl-2-N-(2,2,2-trifluoroethyl)-1,3,5-triazine-2,4-diamine (PubChem CID 80772312) has the molecular formula C11H14F3N7 and a molecular weight of 301.28 g/mol. Its IUPAC name is 4-N-propyl-6-pyrazol-1-yl-2-N-(2,2,2-trifluoroethyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-propyl-6-pyrazol-1-yl-2-N-(2,2,2-trifluoroethyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80772312 |
| Molecular Formula | C11H14F3N7 |
| Molecular Weight | 301.28 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 4-N-propyl-6-pyrazol-1-yl-2-N-(2,2,2-trifluoroethyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCCNc1nc(NCC(F)(F)F)nc(-n2cccn2)n1 |
| InChI | InChI=1S/C11H14F3N7/c1-2-4-15-8-18-9(16-7-11(12,13)14)20-10(19-8)21-6-3-5-17-21/h3,5-6H,2,4,7H2,1H3,(H2,15,16,18,19,20) |
| InChIKey | FSTHYRPIILCUFE-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 80.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.28 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |