C11H18N4 — CID 80776397
4-N-cyclopropyl-2-N,4-N-diethylpyrimidine-2,4-diamine (PubChem CID 80776397) has the molecular formula C11H18N4 and a molecular weight of 206.29 g/mol. Its IUPAC name is 4-N-cyclopropyl-2-N,4-N-diethylpyrimidine-2,4-diamine.
| Compound Name | 4-N-cyclopropyl-2-N,4-N-diethylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80776397 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 4-N-cyclopropyl-2-N,4-N-diethylpyrimidine-2,4-diamine |
| SMILES | CCNc1nccc(N(CC)C2CC2)n1 |
| InChI | InChI=1S/C11H18N4/c1-3-12-11-13-8-7-10(14-11)15(4-2)9-5-6-9/h7-9H,3-6H2,1-2H3,(H,12,13,14) |
| InChIKey | ALFIOOQYYRCYLP-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |