C16H23N5 — CID 80776616
4-N-[4-(dimethylamino)phenyl]-5-methyl-6-N-propylpyrimidine-4,6-diamine (PubChem CID 80776616) has the molecular formula C16H23N5 and a molecular weight of 285.39 g/mol. Its IUPAC name is 4-N-[4-(dimethylamino)phenyl]-5-methyl-6-N-propylpyrimidine-4,6-diamine.
| Compound Name | 4-N-[4-(dimethylamino)phenyl]-5-methyl-6-N-propylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80776616 |
| Molecular Formula | C16H23N5 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | 4-N-[4-(dimethylamino)phenyl]-5-methyl-6-N-propylpyrimidine-4,6-diamine |
| SMILES | CCCNc1ncnc(Nc2ccc(N(C)C)cc2)c1C |
| InChI | InChI=1S/C16H23N5/c1-5-10-17-15-12(2)16(19-11-18-15)20-13-6-8-14(9-7-13)21(3)4/h6-9,11H,5,10H2,1-4H3,(H2,17,18,19,20) |
| InChIKey | LXZZTRIGEXBRDM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|