C13H14N4O2 — CID 80782253
2-nitro-3-N-(1-pyridin-2-ylethyl)benzene-1,3-diamine (PubChem CID 80782253) has the molecular formula C13H14N4O2 and a molecular weight of 258.28 g/mol. Its IUPAC name is 2-nitro-3-N-(1-pyridin-2-ylethyl)benzene-1,3-diamine.
| Compound Name | 2-nitro-3-N-(1-pyridin-2-ylethyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 80782253 |
| Molecular Formula | C13H14N4O2 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 2-nitro-3-N-(1-pyridin-2-ylethyl)benzene-1,3-diamine |
| SMILES | CC(Nc1cccc(N)c1[N+](=O)[O-])c1ccccn1 |
| InChI | InChI=1S/C13H14N4O2/c1-9(11-6-2-3-8-15-11)16-12-7-4-5-10(14)13(12)17(18)19/h2-9,16H,14H2,1H3 |
| InChIKey | ZTYSTECNWMOASK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|