C10H14N4O2S — CID 80783006
2-N-methyl-3-nitro-2-N-(thiolan-3-yl)pyridine-2,6-diamine (PubChem CID 80783006) has the molecular formula C10H14N4O2S and a molecular weight of 254.31 g/mol. Its IUPAC name is 2-N-methyl-3-nitro-2-N-(thiolan-3-yl)pyridine-2,6-diamine.
| Compound Name | 2-N-methyl-3-nitro-2-N-(thiolan-3-yl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 80783006 |
| Molecular Formula | C10H14N4O2S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 2-N-methyl-3-nitro-2-N-(thiolan-3-yl)pyridine-2,6-diamine |
| SMILES | CN(c1nc(N)ccc1[N+](=O)[O-])C1CCSC1 |
| InChI | InChI=1S/C10H14N4O2S/c1-13(7-4-5-17-6-7)10-8(14(15)16)2-3-9(11)12-10/h2-3,7H,4-6H2,1H3,(H2,11,12) |
| InChIKey | YXADQSDOYWASDP-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 85.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|