About 2-N,4-N-dimethyl-4-N-(thiolan-3-yl)quinazoline-2,4-diamine
2-N,4-N-dimethyl-4-N-(thiolan-3-yl)quinazoline-2,4-diamine (PubChem CID 80784259) has the molecular formula C14H18N4S
and a molecular weight of 274.39 g/mol. Its IUPAC name is 2-N,4-N-dimethyl-4-N-(thiolan-3-yl)quinazoline-2,4-diamine.
Molecular Properties
| Compound Name | 2-N,4-N-dimethyl-4-N-(thiolan-3-yl)quinazoline-2,4-diamine |
| PubChem CID | 80784259 |
| Molecular Formula | C14H18N4S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 2-N,4-N-dimethyl-4-N-(thiolan-3-yl)quinazoline-2,4-diamine |
| SMILES | CNc1nc(N(C)C2CCSC2)c2ccccc2n1 |
| InChI | InChI=1S/C14H18N4S/c1-15-14-16-12-6-4-3-5-11(12)13(17-14)18(2)10-7-8-19-9-10/h3-6,10H,7-9H2,1-2H3,(H,15,16,17) |
| InChIKey | MKAFOGSDSWIYCB-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-N,4-N-dimethyl-4-N-(thiolan-3-yl)quinazoline-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,4-N-dimethyl-4-N-(thiolan-3-yl)quinazoline-2,4-diamine?
The IUPAC name of 2-N,4-N-dimethyl-4-N-(thiolan-3-yl)quinazoline-2,4-diamine (CID 80784259) is 2-N,4-N-dimethyl-4-N-(thiolan-3-yl)quinazoline-2,4-diamine.
What is the SMILES notation for 2-N,4-N-dimethyl-4-N-(thiolan-3-yl)quinazoline-2,4-diamine?
The canonical SMILES for 2-N,4-N-dimethyl-4-N-(thiolan-3-yl)quinazoline-2,4-diamine is CNc1nc(N(C)C2CCSC2)c2ccccc2n1.
What is the InChIKey of 2-N,4-N-dimethyl-4-N-(thiolan-3-yl)quinazoline-2,4-diamine?
The InChIKey is MKAFOGSDSWIYCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N4S/c1-15-14-16-12-6-4-3-5-11(12)13(17-14)18(2)10-7-8-19-9-10/h3-6,10H,7-9H2,1-2H3,(H,15,16,17).
What are the key properties of 2-N,4-N-dimethyl-4-N-(thiolan-3-yl)quinazoline-2,4-diamine?
2-N,4-N-dimethyl-4-N-(thiolan-3-yl)quinazoline-2,4-diamine has a molecular weight of 274.39 g/mol, XLogP of 2.61, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,4-N-dimethyl-4-N-(thiolan-3-yl)quinazoline-2,4-diamine is sourced from PubChem (CID 80784259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).