C14H22ClN5O — CID 80784866
1-[5-chloro-2-(propylamino)pyrimidin-4-yl]-N-methylpiperidine-2-carboxamide (PubChem CID 80784866) has the molecular formula C14H22ClN5O and a molecular weight of 311.82 g/mol. Its IUPAC name is 1-[5-chloro-2-(propylamino)pyrimidin-4-yl]-N-methylpiperidine-2-carboxamide.
| Compound Name | 1-[5-chloro-2-(propylamino)pyrimidin-4-yl]-N-methylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 80784866 |
| Molecular Formula | C14H22ClN5O |
| Molecular Weight | 311.82 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 1-[5-chloro-2-(propylamino)pyrimidin-4-yl]-N-methylpiperidine-2-carboxamide |
| SMILES | CCCNc1ncc(Cl)c(N2CCCCC2C(=O)NC)n1 |
| InChI | InChI=1S/C14H22ClN5O/c1-3-7-17-14-18-9-10(15)12(19-14)20-8-5-4-6-11(20)13(21)16-2/h9,11H,3-8H2,1-2H3,(H,16,21)(H,17,18,19) |
| InChIKey | ONOFRQWSIXQNGY-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.82 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |