C9H11F3N8 — CID 80785793
4-N-ethyl-6-(1,2,4-triazol-1-yl)-2-N-(2,2,2-trifluoroethyl)-1,3,5-triazine-2,4-diamine (PubChem CID 80785793) has the molecular formula C9H11F3N8 and a molecular weight of 288.24 g/mol. Its IUPAC name is 4-N-ethyl-6-(1,2,4-triazol-1-yl)-2-N-(2,2,2-trifluoroethyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-ethyl-6-(1,2,4-triazol-1-yl)-2-N-(2,2,2-trifluoroethyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80785793 |
| Molecular Formula | C9H11F3N8 |
| Molecular Weight | 288.24 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 4-N-ethyl-6-(1,2,4-triazol-1-yl)-2-N-(2,2,2-trifluoroethyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCNc1nc(NCC(F)(F)F)nc(-n2cncn2)n1 |
| InChI | InChI=1S/C9H11F3N8/c1-2-14-6-17-7(15-3-9(10,11)12)19-8(18-6)20-5-13-4-16-20/h4-5H,2-3H2,1H3,(H2,14,15,17,18,19) |
| InChIKey | DCHRFVIRJJWQSS-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 93.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.24 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |