C13H18N4O — CID 80786241
4-N-(1-methoxypropan-2-yl)-2-N-methylquinazoline-2,4-diamine (PubChem CID 80786241) has the molecular formula C13H18N4O and a molecular weight of 246.31 g/mol. Its IUPAC name is 4-N-(1-methoxypropan-2-yl)-2-N-methylquinazoline-2,4-diamine.
| Compound Name | 4-N-(1-methoxypropan-2-yl)-2-N-methylquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 80786241 |
| Molecular Formula | C13H18N4O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 4-N-(1-methoxypropan-2-yl)-2-N-methylquinazoline-2,4-diamine |
| SMILES | CNc1nc(NC(C)COC)c2ccccc2n1 |
| InChI | InChI=1S/C13H18N4O/c1-9(8-18-3)15-12-10-6-4-5-7-11(10)16-13(14-2)17-12/h4-7,9H,8H2,1-3H3,(H2,14,15,16,17) |
| InChIKey | OJQXIUFGPDIKDO-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |