C14H16N6 — CID 80788971
8-N-[4-(dimethylamino)phenyl]imidazo[1,2-a]pyrazine-6,8-diamine (PubChem CID 80788971) has the molecular formula C14H16N6 and a molecular weight of 268.32 g/mol. Its IUPAC name is 8-N-[4-(dimethylamino)phenyl]imidazo[1,2-a]pyrazine-6,8-diamine.
| Compound Name | 8-N-[4-(dimethylamino)phenyl]imidazo[1,2-a]pyrazine-6,8-diamine |
|---|---|
| PubChem CID | 80788971 |
| Molecular Formula | C14H16N6 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 8-N-[4-(dimethylamino)phenyl]imidazo[1,2-a]pyrazine-6,8-diamine |
| SMILES | CN(C)c1ccc(Nc2nc(N)cn3ccnc23)cc1 |
| InChI | InChI=1S/C14H16N6/c1-19(2)11-5-3-10(4-6-11)17-13-14-16-7-8-20(14)9-12(15)18-13/h3-9H,15H2,1-2H3,(H,17,18) |
| InChIKey | TYPOHAXKPKZTOU-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 71.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|