C10H16N4O2S — CID 80789043
4-N-(1,1-dioxothian-4-yl)-6-methylpyrimidine-2,4-diamine (PubChem CID 80789043) has the molecular formula C10H16N4O2S and a molecular weight of 256.33 g/mol. Its IUPAC name is 4-N-(1,1-dioxothian-4-yl)-6-methylpyrimidine-2,4-diamine.
| Compound Name | 4-N-(1,1-dioxothian-4-yl)-6-methylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80789043 |
| Molecular Formula | C10H16N4O2S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 4-N-(1,1-dioxothian-4-yl)-6-methylpyrimidine-2,4-diamine |
| SMILES | Cc1cc(NC2CCS(=O)(=O)CC2)nc(N)n1 |
| InChI | InChI=1S/C10H16N4O2S/c1-7-6-9(14-10(11)12-7)13-8-2-4-17(15,16)5-3-8/h6,8H,2-5H2,1H3,(H3,11,12,13,14) |
| InChIKey | BTSAJBROQJYYDT-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |