C12H20N4O — CID 80789183
6-N-ethyl-5-methyl-4-N-(oxan-4-yl)pyrimidine-4,6-diamine (PubChem CID 80789183) has the molecular formula C12H20N4O and a molecular weight of 236.32 g/mol. Its IUPAC name is 6-N-ethyl-5-methyl-4-N-(oxan-4-yl)pyrimidine-4,6-diamine.
| Compound Name | 6-N-ethyl-5-methyl-4-N-(oxan-4-yl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80789183 |
| Molecular Formula | C12H20N4O |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 6-N-ethyl-5-methyl-4-N-(oxan-4-yl)pyrimidine-4,6-diamine |
| SMILES | CCNc1ncnc(NC2CCOCC2)c1C |
| InChI | InChI=1S/C12H20N4O/c1-3-13-11-9(2)12(15-8-14-11)16-10-4-6-17-7-5-10/h8,10H,3-7H2,1-2H3,(H2,13,14,15,16) |
| InChIKey | SUYLLOUELPBZOF-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |