C17H27N3 — CID 80789221
6-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-N-propylpyridin-2-amine (PubChem CID 80789221) has the molecular formula C17H27N3 and a molecular weight of 273.42 g/mol. Its IUPAC name is 6-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-N-propylpyridin-2-amine.
| Compound Name | 6-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-N-propylpyridin-2-amine |
|---|---|
| PubChem CID | 80789221 |
| Molecular Formula | C17H27N3 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.22 |
| IUPAC Name | 6-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-N-propylpyridin-2-amine |
| SMILES | CCCNc1cccc(N2CCC3CCCCC3C2)n1 |
| InChI | InChI=1S/C17H27N3/c1-2-11-18-16-8-5-9-17(19-16)20-12-10-14-6-3-4-7-15(14)13-20/h5,8-9,14-15H,2-4,6-7,10-13H2,1H3,(H,18,19) |
| InChIKey | MMZBMVWVPKWFID-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |