C11H14F3N5O2 — CID 80789522
4-N-cyclopropyl-6-N-ethyl-5-nitro-4-N-(2,2,2-trifluoroethyl)pyrimidine-4,6-diamine (PubChem CID 80789522) has the molecular formula C11H14F3N5O2 and a molecular weight of 305.26 g/mol. Its IUPAC name is 4-N-cyclopropyl-6-N-ethyl-5-nitro-4-N-(2,2,2-trifluoroethyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N-cyclopropyl-6-N-ethyl-5-nitro-4-N-(2,2,2-trifluoroethyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80789522 |
| Molecular Formula | C11H14F3N5O2 |
| Molecular Weight | 305.26 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 4-N-cyclopropyl-6-N-ethyl-5-nitro-4-N-(2,2,2-trifluoroethyl)pyrimidine-4,6-diamine |
| SMILES | CCNc1ncnc(N(CC(F)(F)F)C2CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H14F3N5O2/c1-2-15-9-8(19(20)21)10(17-6-16-9)18(7-3-4-7)5-11(12,13)14/h6-7H,2-5H2,1H3,(H,15,16,17) |
| InChIKey | DSGYBGUTNGITOF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 84.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.26 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|