C10H13F3N8 — CID 80789738
4-N-ethyl-2-N-methyl-6-(1,2,4-triazol-1-yl)-4-N-(2,2,2-trifluoroethyl)-1,3,5-triazine-2,4-diamine (PubChem CID 80789738) has the molecular formula C10H13F3N8 and a molecular weight of 302.26 g/mol. Its IUPAC name is 4-N-ethyl-2-N-methyl-6-(1,2,4-triazol-1-yl)-4-N-(2,2,2-trifluoroethyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-ethyl-2-N-methyl-6-(1,2,4-triazol-1-yl)-4-N-(2,2,2-trifluoroethyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80789738 |
| Molecular Formula | C10H13F3N8 |
| Molecular Weight | 302.26 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 4-N-ethyl-2-N-methyl-6-(1,2,4-triazol-1-yl)-4-N-(2,2,2-trifluoroethyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCN(CC(F)(F)F)c1nc(NC)nc(-n2cncn2)n1 |
| InChI | InChI=1S/C10H13F3N8/c1-3-20(4-10(11,12)13)8-17-7(14-2)18-9(19-8)21-6-15-5-16-21/h5-6H,3-4H2,1-2H3,(H,14,17,18,19) |
| InChIKey | KJSSUVSNDKVMLX-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 84.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.26 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |