C13H17N7O — CID 80790707
4-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-6-pyrazol-1-yl-1,3,5-triazin-2-amine (PubChem CID 80790707) has the molecular formula C13H17N7O and a molecular weight of 287.33 g/mol. Its IUPAC name is 4-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-6-pyrazol-1-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-6-pyrazol-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80790707 |
| Molecular Formula | C13H17N7O |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 4-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-6-pyrazol-1-yl-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(N2CCOC3CCCC32)nc(-n2cccn2)n1 |
| InChI | InChI=1S/C13H17N7O/c14-11-16-12(18-13(17-11)20-6-2-5-15-20)19-7-8-21-10-4-1-3-9(10)19/h2,5-6,9-10H,1,3-4,7-8H2,(H2,14,16,17,18) |
| InChIKey | YDSSMBBSFKGXLN-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |