About 5-methyl-6-(1,4-thiazepan-4-yl)pyrimidin-4-amine
5-methyl-6-(1,4-thiazepan-4-yl)pyrimidin-4-amine (PubChem CID 80795248) has the molecular formula C10H16N4S
and a molecular weight of 224.33 g/mol. Its IUPAC name is 5-methyl-6-(1,4-thiazepan-4-yl)pyrimidin-4-amine.
Molecular Properties
| Compound Name | 5-methyl-6-(1,4-thiazepan-4-yl)pyrimidin-4-amine |
| PubChem CID | 80795248 |
| Molecular Formula | C10H16N4S |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 5-methyl-6-(1,4-thiazepan-4-yl)pyrimidin-4-amine |
| SMILES | Cc1c(N)ncnc1N1CCCSCC1 |
| InChI | InChI=1S/C10H16N4S/c1-8-9(11)12-7-13-10(8)14-3-2-5-15-6-4-14/h7H,2-6H2,1H3,(H2,11,12,13) |
| InChIKey | KZJZEHYPQKPTCB-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-methyl-6-(1,4-thiazepan-4-yl)pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-6-(1,4-thiazepan-4-yl)pyrimidin-4-amine?
The IUPAC name of 5-methyl-6-(1,4-thiazepan-4-yl)pyrimidin-4-amine (CID 80795248) is 5-methyl-6-(1,4-thiazepan-4-yl)pyrimidin-4-amine.
What is the SMILES notation for 5-methyl-6-(1,4-thiazepan-4-yl)pyrimidin-4-amine?
The canonical SMILES for 5-methyl-6-(1,4-thiazepan-4-yl)pyrimidin-4-amine is Cc1c(N)ncnc1N1CCCSCC1.
What is the InChIKey of 5-methyl-6-(1,4-thiazepan-4-yl)pyrimidin-4-amine?
The InChIKey is KZJZEHYPQKPTCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4S/c1-8-9(11)12-7-13-10(8)14-3-2-5-15-6-4-14/h7H,2-6H2,1H3,(H2,11,12,13).
What are the key properties of 5-methyl-6-(1,4-thiazepan-4-yl)pyrimidin-4-amine?
5-methyl-6-(1,4-thiazepan-4-yl)pyrimidin-4-amine has a molecular weight of 224.33 g/mol, XLogP of 1.31, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-6-(1,4-thiazepan-4-yl)pyrimidin-4-amine is sourced from PubChem (CID 80795248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).