C14H24ClN5 — CID 80796160
4-(4-tert-butylpiperazin-1-yl)-5-chloro-N-ethylpyrimidin-2-amine (PubChem CID 80796160) has the molecular formula C14H24ClN5 and a molecular weight of 297.83 g/mol. Its IUPAC name is 4-(4-tert-butylpiperazin-1-yl)-5-chloro-N-ethylpyrimidin-2-amine.
| Compound Name | 4-(4-tert-butylpiperazin-1-yl)-5-chloro-N-ethylpyrimidin-2-amine |
|---|---|
| PubChem CID | 80796160 |
| Molecular Formula | C14H24ClN5 |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 4-(4-tert-butylpiperazin-1-yl)-5-chloro-N-ethylpyrimidin-2-amine |
| SMILES | CCNc1ncc(Cl)c(N2CCN(C(C)(C)C)CC2)n1 |
| InChI | InChI=1S/C14H24ClN5/c1-5-16-13-17-10-11(15)12(18-13)19-6-8-20(9-7-19)14(2,3)4/h10H,5-9H2,1-4H3,(H,16,17,18) |
| InChIKey | CSSHMUPVSWWEQC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |