About 5-chloro-4-N-(2-methoxyethyl)-2-N,4-N-dimethylpyrimidine-2,4-diamine
5-chloro-4-N-(2-methoxyethyl)-2-N,4-N-dimethylpyrimidine-2,4-diamine (PubChem CID 80796727) has the molecular formula C9H15ClN4O
and a molecular weight of 230.70 g/mol. Its IUPAC name is 5-chloro-4-N-(2-methoxyethyl)-2-N,4-N-dimethylpyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 5-chloro-4-N-(2-methoxyethyl)-2-N,4-N-dimethylpyrimidine-2,4-diamine |
| PubChem CID | 80796727 |
| Molecular Formula | C9H15ClN4O |
| Molecular Weight | 230.70 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 5-chloro-4-N-(2-methoxyethyl)-2-N,4-N-dimethylpyrimidine-2,4-diamine |
| SMILES | CNc1ncc(Cl)c(N(C)CCOC)n1 |
| InChI | InChI=1S/C9H15ClN4O/c1-11-9-12-6-7(10)8(13-9)14(2)4-5-15-3/h6H,4-5H2,1-3H3,(H,11,12,13) |
| InChIKey | FMBWOFUMJQMNBU-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.70 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-chloro-4-N-(2-methoxyethyl)-2-N,4-N-dimethylpyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-4-N-(2-methoxyethyl)-2-N,4-N-dimethylpyrimidine-2,4-diamine?
The IUPAC name of 5-chloro-4-N-(2-methoxyethyl)-2-N,4-N-dimethylpyrimidine-2,4-diamine (CID 80796727) is 5-chloro-4-N-(2-methoxyethyl)-2-N,4-N-dimethylpyrimidine-2,4-diamine.
What is the SMILES notation for 5-chloro-4-N-(2-methoxyethyl)-2-N,4-N-dimethylpyrimidine-2,4-diamine?
The canonical SMILES for 5-chloro-4-N-(2-methoxyethyl)-2-N,4-N-dimethylpyrimidine-2,4-diamine is CNc1ncc(Cl)c(N(C)CCOC)n1.
What is the InChIKey of 5-chloro-4-N-(2-methoxyethyl)-2-N,4-N-dimethylpyrimidine-2,4-diamine?
The InChIKey is FMBWOFUMJQMNBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15ClN4O/c1-11-9-12-6-7(10)8(13-9)14(2)4-5-15-3/h6H,4-5H2,1-3H3,(H,11,12,13).
What are the key properties of 5-chloro-4-N-(2-methoxyethyl)-2-N,4-N-dimethylpyrimidine-2,4-diamine?
5-chloro-4-N-(2-methoxyethyl)-2-N,4-N-dimethylpyrimidine-2,4-diamine has a molecular weight of 230.70 g/mol, XLogP of 1.25, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-4-N-(2-methoxyethyl)-2-N,4-N-dimethylpyrimidine-2,4-diamine is sourced from PubChem (CID 80796727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).