C16H28N4 — CID 80797402
6-(2-ethylpyrrolidin-1-yl)-N,5-dipropylpyrimidin-4-amine (PubChem CID 80797402) has the molecular formula C16H28N4 and a molecular weight of 276.43 g/mol. Its IUPAC name is 6-(2-ethylpyrrolidin-1-yl)-N,5-dipropylpyrimidin-4-amine.
| Compound Name | 6-(2-ethylpyrrolidin-1-yl)-N,5-dipropylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80797402 |
| Molecular Formula | C16H28N4 |
| Molecular Weight | 276.43 g/mol |
| Exact Mass | 276.23 |
| IUPAC Name | 6-(2-ethylpyrrolidin-1-yl)-N,5-dipropylpyrimidin-4-amine |
| SMILES | CCCNc1ncnc(N2CCCC2CC)c1CCC |
| InChI | InChI=1S/C16H28N4/c1-4-8-14-15(17-10-5-2)18-12-19-16(14)20-11-7-9-13(20)6-3/h12-13H,4-11H2,1-3H3,(H,17,18,19) |
| InChIKey | OZYBFMHSUXPPMR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.43 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |