C10H15N5O2 — CID 80798120
6-(2-ethylpyrrolidin-1-yl)-5-nitropyrimidin-4-amine (PubChem CID 80798120) has the molecular formula C10H15N5O2 and a molecular weight of 237.26 g/mol. Its IUPAC name is 6-(2-ethylpyrrolidin-1-yl)-5-nitropyrimidin-4-amine.
| Compound Name | 6-(2-ethylpyrrolidin-1-yl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 80798120 |
| Molecular Formula | C10H15N5O2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 6-(2-ethylpyrrolidin-1-yl)-5-nitropyrimidin-4-amine |
| SMILES | CCC1CCCN1c1ncnc(N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H15N5O2/c1-2-7-4-3-5-14(7)10-8(15(16)17)9(11)12-6-13-10/h6-7H,2-5H2,1H3,(H2,11,12,13) |
| InChIKey | AEJPGAFOXLZKEB-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 98.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|