C13H20N6S — CID 80800490
6-N-ethyl-2-N,2-N-dimethyl-4-N-(2-thiophen-3-ylethyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 80800490) has the molecular formula C13H20N6S and a molecular weight of 292.41 g/mol. Its IUPAC name is 6-N-ethyl-2-N,2-N-dimethyl-4-N-(2-thiophen-3-ylethyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-N-ethyl-2-N,2-N-dimethyl-4-N-(2-thiophen-3-ylethyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 80800490 |
| Molecular Formula | C13H20N6S |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 6-N-ethyl-2-N,2-N-dimethyl-4-N-(2-thiophen-3-ylethyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCNc1nc(NCCc2ccsc2)nc(N(C)C)n1 |
| InChI | InChI=1S/C13H20N6S/c1-4-14-11-16-12(18-13(17-11)19(2)3)15-7-5-10-6-8-20-9-10/h6,8-9H,4-5,7H2,1-3H3,(H2,14,15,16,17,18) |
| InChIKey | SHFVNLDICMNHJD-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |