C14H24N4 — CID 80803646
4-N-(2-ethylcyclohexyl)-6-N,2-dimethylpyrimidine-4,6-diamine (PubChem CID 80803646) has the molecular formula C14H24N4 and a molecular weight of 248.37 g/mol. Its IUPAC name is 4-N-(2-ethylcyclohexyl)-6-N,2-dimethylpyrimidine-4,6-diamine.
| Compound Name | 4-N-(2-ethylcyclohexyl)-6-N,2-dimethylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80803646 |
| Molecular Formula | C14H24N4 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | 4-N-(2-ethylcyclohexyl)-6-N,2-dimethylpyrimidine-4,6-diamine |
| SMILES | CCC1CCCCC1Nc1cc(NC)nc(C)n1 |
| InChI | InChI=1S/C14H24N4/c1-4-11-7-5-6-8-12(11)18-14-9-13(15-3)16-10(2)17-14/h9,11-12H,4-8H2,1-3H3,(H2,15,16,17,18) |
| InChIKey | ZBANLXYMWRQHMK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |