C15H25N5 — CID 80804615
4-N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)-5-methyl-2-N-propylpyrimidine-2,4-diamine (PubChem CID 80804615) has the molecular formula C15H25N5 and a molecular weight of 275.40 g/mol. Its IUPAC name is 4-N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)-5-methyl-2-N-propylpyrimidine-2,4-diamine.
| Compound Name | 4-N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)-5-methyl-2-N-propylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80804615 |
| Molecular Formula | C15H25N5 |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.21 |
| IUPAC Name | 4-N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)-5-methyl-2-N-propylpyrimidine-2,4-diamine |
| SMILES | CCCNc1ncc(C)c(NC2CCN3CCCC23)n1 |
| InChI | InChI=1S/C15H25N5/c1-3-7-16-15-17-10-11(2)14(19-15)18-12-6-9-20-8-4-5-13(12)20/h10,12-13H,3-9H2,1-2H3,(H2,16,17,18,19) |
| InChIKey | WZUAEMQQTBZFDK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |