About 8-(1-oxo-1,4-thiazinan-4-yl)imidazo[1,2-a]pyrazin-6-amine
8-(1-oxo-1,4-thiazinan-4-yl)imidazo[1,2-a]pyrazin-6-amine (PubChem CID 80804872) has the molecular formula C10H13N5OS
and a molecular weight of 251.31 g/mol. Its IUPAC name is 8-(1-oxo-1,4-thiazinan-4-yl)imidazo[1,2-a]pyrazin-6-amine.
Molecular Properties
| Compound Name | 8-(1-oxo-1,4-thiazinan-4-yl)imidazo[1,2-a]pyrazin-6-amine |
| PubChem CID | 80804872 |
| Molecular Formula | C10H13N5OS |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 8-(1-oxo-1,4-thiazinan-4-yl)imidazo[1,2-a]pyrazin-6-amine |
| SMILES | Nc1cn2ccnc2c(N2CCS(=O)CC2)n1 |
| InChI | InChI=1S/C10H13N5OS/c11-8-7-15-2-1-12-9(15)10(13-8)14-3-5-17(16)6-4-14/h1-2,7H,3-6,11H2 |
| InChIKey | UHAYPMRDMKDKBS-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 76.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 8-(1-oxo-1,4-thiazinan-4-yl)imidazo[1,2-a]pyrazin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(1-oxo-1,4-thiazinan-4-yl)imidazo[1,2-a]pyrazin-6-amine?
The IUPAC name of 8-(1-oxo-1,4-thiazinan-4-yl)imidazo[1,2-a]pyrazin-6-amine (CID 80804872) is 8-(1-oxo-1,4-thiazinan-4-yl)imidazo[1,2-a]pyrazin-6-amine.
What is the SMILES notation for 8-(1-oxo-1,4-thiazinan-4-yl)imidazo[1,2-a]pyrazin-6-amine?
The canonical SMILES for 8-(1-oxo-1,4-thiazinan-4-yl)imidazo[1,2-a]pyrazin-6-amine is Nc1cn2ccnc2c(N2CCS(=O)CC2)n1.
What is the InChIKey of 8-(1-oxo-1,4-thiazinan-4-yl)imidazo[1,2-a]pyrazin-6-amine?
The InChIKey is UHAYPMRDMKDKBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N5OS/c11-8-7-15-2-1-12-9(15)10(13-8)14-3-5-17(16)6-4-14/h1-2,7H,3-6,11H2.
What are the key properties of 8-(1-oxo-1,4-thiazinan-4-yl)imidazo[1,2-a]pyrazin-6-amine?
8-(1-oxo-1,4-thiazinan-4-yl)imidazo[1,2-a]pyrazin-6-amine has a molecular weight of 251.31 g/mol, XLogP of -0.12, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(1-oxo-1,4-thiazinan-4-yl)imidazo[1,2-a]pyrazin-6-amine is sourced from PubChem (CID 80804872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).