C12H20N4OS — CID 80805279
N,5-diethyl-6-(1-oxo-1,4-thiazinan-4-yl)pyrimidin-4-amine (PubChem CID 80805279) has the molecular formula C12H20N4OS and a molecular weight of 268.39 g/mol. Its IUPAC name is N,5-diethyl-6-(1-oxo-1,4-thiazinan-4-yl)pyrimidin-4-amine.
| Compound Name | N,5-diethyl-6-(1-oxo-1,4-thiazinan-4-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80805279 |
| Molecular Formula | C12H20N4OS |
| Molecular Weight | 268.39 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | N,5-diethyl-6-(1-oxo-1,4-thiazinan-4-yl)pyrimidin-4-amine |
| SMILES | CCNc1ncnc(N2CCS(=O)CC2)c1CC |
| InChI | InChI=1S/C12H20N4OS/c1-3-10-11(13-4-2)14-9-15-12(10)16-5-7-18(17)8-6-16/h9H,3-8H2,1-2H3,(H,13,14,15) |
| InChIKey | MOLFRLUKUFXUHE-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.39 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |